What is the 2-methoxybut-2-ene?

2-methoxybut-2-ene is , while it's Molecular Formula is C5H10O. Used in Organic Synthesis: 2-methoxybut-2-ene is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for versatile chemical reactions, making it a valuable building block in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Used in Chemical Reactions as a Reagent: As a reagent, 2-methoxybut-2-ene is employed in a wide range of chemical reactions to facilitate the formation of desired products. Its reactivity and functional groups enable it to participate in various reaction mechanisms, such as nucleophilic addition, elimination, and substitution reactions. Used in Pharmaceutical Industry: In the pharmaceutical industry, 2-methoxybut-2-ene is used as a starting material for the synthesis of various drug molecules. Its ability to undergo a variety of chemical transformations makes it an essential component in the development of new medications and therapeutic agents. Used in Agrochemical Industry: 2-methoxybut-2-ene is also utilized in the agrochemical industry for the synthesis of active ingredients in pesticides and herbicides. Its versatility in chemical reactions allows for the creation of novel compounds with improved efficacy and selectivity. Used in Specialty Chemicals Production: In the production of specialty chemicals, 2-methoxybut-2-ene serves as a crucial precursor for the synthesis of various high-value compounds. Its unique properties and reactivity contribute to the development of innovative materials with specific applications in industries such as coatings, adhesives, and polymers.

What is the CAS number for 2-methoxybut-2-ene?

The CAS number of 2-methoxybut-2-ene is 6380-95-6.

What is 2-methoxybut-2-ene (6380-95-6) used for?

2-methoxybut-2-ene, also known as glycidol, is a chemical compound with the molecular formula C5H10O. It is a clear, colorless liquid that exhibits a fruity odor. This versatile compound is used in various applications, including the synthesis of organic compounds and as a reagent in chemical reactions. However, it is also flammable and can react violently with oxidizing agents, making it a potential hazard. Additionally, 2-methoxybut-2-ene is classified as a potential carcinogen and mutagen, necessitating careful handling and minimized exposure to prevent adverse health effects.InChI:InChI=1/C5H10O/c1-4-5(2)6-3/h4H,1-3H3/b5-4-

What is the 2-methoxybut-2-ene?

2-methoxybut-2-ene is , while it's Molecular Formula is C5H10O. Used in Organic Synthesis: 2-methoxybut-2-ene is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for versatile chemical reactions, making it a valuable building block in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Used in Chemical Reactions as a Reagent: As a reagent, 2-methoxybut-2-ene is employed in a wide range of chemical reactions to facilitate the formation of desired products. Its reactivity and functional groups enable it to participate in various reaction mechanisms, such as nucleophilic addition, elimination, and substitution reactions. Used in Pharmaceutical Industry: In the pharmaceutical industry, 2-methoxybut-2-ene is used as a starting material for the synthesis of various drug molecules. Its ability to undergo a variety of chemical transformations makes it an essential component in the development of new medications and therapeutic agents. Used in Agrochemical Industry: 2-methoxybut-2-ene is also utilized in the agrochemical industry for the synthesis of active ingredients in pesticides and herbicides. Its versatility in chemical reactions allows for the creation of novel compounds with improved efficacy and selectivity. Used in Specialty Chemicals Production: In the production of specialty chemicals, 2-methoxybut-2-ene serves as a crucial precursor for the synthesis of various high-value compounds. Its unique properties and reactivity contribute to the development of innovative materials with specific applications in industries such as coatings, adhesives, and polymers.

What is the CAS number for 2-methoxybut-2-ene?

The CAS number of 2-methoxybut-2-ene is 6380-95-6.

What is 2-methoxybut-2-ene (6380-95-6) used for?

2-methoxybut-2-ene, also known as glycidol, is a chemical compound with the molecular formula C5H10O. It is a clear, colorless liquid that exhibits a fruity odor. This versatile compound is used in various applications, including the synthesis of organic compounds and as a reagent in chemical reactions. However, it is also flammable and can react violently with oxidizing agents, making it a potential hazard. Additionally, 2-methoxybut-2-ene is classified as a potential carcinogen and mutagen, necessitating careful handling and minimized exposure to prevent adverse health effects.InChI:InChI=1/C5H10O/c1-4-5(2)6-3/h4H,1-3H3/b5-4-

Your Location: Home > Organic Chemicals > 2-methoxybut-2-ene

2-methoxybut-2-ene

Cas number：6380-95-6
purity：99%

Post inquiry

Product Details

Top Quality Chinese Factory supply 6380-95-6 2-methoxybut-2-ene

Molecular Formula: C5H10O
Molecular Weight: 86.1338
Vapor Pressure: 160mmHg at 25°C
Refractive Index: 1.399
Boiling Point: 67 °C at 760 mmHg
PSA： 9.23000
Density: 0.777 g/cm³
LogP: 1.55650

2-methoxybut-2-ene(Cas 6380-95-6) Usage

General Description

2-methoxybut-2-ene is a chemical compound with the molecular formula C5H10O. It is a clear, colorless liquid with a fruity odor, and it is also known by the trade name glycidol. 2-methoxybut-2-ene is used in the synthesis of organic compounds and as a reagent in chemical reactions. It is flammable and should be handled with caution, as it can react violently with oxidizing agents. This chemical is also a potential carcinogen and mutagen, and exposure to it should be minimized to prevent adverse health effects. Overall, 2-methoxybut-2-ene is a versatile compound with various applications, but its potential hazards should be carefully considered when handling and using it in industrial and research settings.

InChI:InChI=1/C5H10O/c1-4-5(2)6-3/h4H,1-3H3/b5-4-